CAS 3002983-52-7 is the registry number for (E)-ethyl 4,4,4-trifluoro-2-(2-hydroxybenzylidene)-3-oxobutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (2E)-4,4,4-trifluoro-2-[(2-hydroxyphenyl)methylidene]-3-oxobutanoate (CAS 3002983-52-7) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: ethyl (2E)-4,4,4-trifluoro-2-[(2-hydroxyphenyl)methylidene]-3-oxobutanoate. InChIKey: MEEQYTZEFHCJOM-VQHVLOKHSA-N.
| Molecular formula | C13H11F3O4 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | ethyl (2E)-4,4,4-trifluoro-2-[(2-hydroxyphenyl)methylidene]-3-oxobutanoate |
| InChIKey | MEEQYTZEFHCJOM-VQHVLOKHSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC=C1O)/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)