Products 3006105-55-8
CAS 3006105-55-8 appears in our catalog under these names: GPR55 agonist 4, GPR55 agonist 4, 98.36%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM/1mL, 10 mg, 5 mg, 50 mg, 100 mg.
5-[3-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1,2,4-triazin-6-yl]-3-methyl-1,3-benzoxazol-2-one (CAS 3006105-55-8) is a chemical compound with the molecular formula C19H16FN5O2 and a molecular weight of 365.4 g/mol. IUPAC name: 5-[3-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1,2,4-triazin-6-yl]-3-methyl-1,3-benzoxazol-2-one. InChIKey: YMMHFOXSAMBHAZ-LLVKDONJSA-N.
| Molecular formula | C19H16FN5O2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 5-[3-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-1,2,4-triazin-6-yl]-3-methyl-1,3-benzoxazol-2-one |
| InChIKey | YMMHFOXSAMBHAZ-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)F)NC2=NC=C(N=N2)C3=CC4=C(C=C3)OC(=O)N4C |
Computed by PubChem (NCBI)