CAS 3012561-08-6 is the registry number for Fmoc-L-MeTrp(7-F)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 100mg.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(7-fluoro-1H-indol-3-yl)propanoic acid (CAS 3012561-08-6) is a chemical compound with the molecular formula C27H23FN2O4 and a molecular weight of 458.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(7-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: VREFWYMFNWBBFY-DEOSSOPVSA-N.
| Molecular formula | C27H23FN2O4 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(7-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | VREFWYMFNWBBFY-DEOSSOPVSA-N |
| SMILES | CN([C@@H](CC1=CNC2=C1C=CC=C2F)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)