CAS 3014368-75-0 is the registry number for 1,3,5-Trifluoro-2,4,6-tris(4-acetylphenyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-[3,5-bis(4-acetylphenyl)-2,4,6-trifluorophenyl]phenyl]ethanone (CAS 3014368-75-0) is a chemical compound with the molecular formula C30H21F3O3 and a molecular weight of 486.5 g/mol. IUPAC name: 1-[4-[3,5-bis(4-acetylphenyl)-2,4,6-trifluorophenyl]phenyl]ethanone. InChIKey: CNPDTDZTMFABDA-UHFFFAOYSA-N.
| Molecular formula | C30H21F3O3 |
|---|---|
| Molecular weight | 486.5 g/mol |
| IUPAC name | 1-[4-[3,5-bis(4-acetylphenyl)-2,4,6-trifluorophenyl]phenyl]ethanone |
| InChIKey | CNPDTDZTMFABDA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=C(C(=C(C(=C2F)C3=CC=C(C=C3)C(=O)C)F)C4=CC=C(C=C4)C(=O)C)F |
Computed by PubChem (NCBI)