Products 3023217-85-5
CAS 3023217-85-5 is the registry number for MAO-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-1-benzofuran-2-ylmethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine (CAS 3023217-85-5) is a chemical compound with the molecular formula C18H11Cl2N3OS and a molecular weight of 388.3 g/mol. IUPAC name: N-[(E)-1-benzofuran-2-ylmethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine. InChIKey: IPZRVBNSMGZXTO-ZVBGSRNCSA-N.
| Molecular formula | C18H11Cl2N3OS |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | N-[(E)-1-benzofuran-2-ylmethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | IPZRVBNSMGZXTO-ZVBGSRNCSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)/C=N/NC3=NC(=CS3)C4=C(C=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)