CAS 3023450-07-6 is the registry number for (R)-3-(2,6-Difluoro-4-(3-hydroxyazetidin-1-yl)phenyl)piperidine-2,6-dione, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-[2,6-difluoro-4-(3-hydroxyazetidin-1-yl)phenyl]piperidine-2,6-dione (CAS 3023450-07-6) is a chemical compound with the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. IUPAC name: (3R)-3-[2,6-difluoro-4-(3-hydroxyazetidin-1-yl)phenyl]piperidine-2,6-dione. InChIKey: WYZOIMJMDOKEBR-SECBINFHSA-N.
| Molecular formula | C14H14F2N2O3 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | (3R)-3-[2,6-difluoro-4-(3-hydroxyazetidin-1-yl)phenyl]piperidine-2,6-dione |
| InChIKey | WYZOIMJMDOKEBR-SECBINFHSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1C2=C(C=C(C=C2F)N3CC(C3)O)F |
Computed by PubChem (NCBI)