Products 3024547-15-4
CAS 3024547-15-4 is the registry number for 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbonitrile (CAS 3024547-15-4) is a chemical compound with the molecular formula C15H17BN2O2 and a molecular weight of 268.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbonitrile. InChIKey: BOZHADDYRQLWBY-UHFFFAOYSA-N.
| Molecular formula | C15H17BN2O2 |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carbonitrile |
| InChIKey | BOZHADDYRQLWBY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=CN3)C#N |
Computed by PubChem (NCBI)