Products 3026676-69-4
CAS 3026676-69-4 is the registry number for 2-Amino-3-(4-chloro-3-hydroxyphenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-3-(4-chloro-3-hydroxyphenyl)propanoic acid;hydrochloride (CAS 3026676-69-4) is a chemical compound with the molecular formula C9H11Cl2NO3 and a molecular weight of 252.09 g/mol. IUPAC name: 2-amino-3-(4-chloro-3-hydroxyphenyl)propanoic acid;hydrochloride. InChIKey: JLLKYXUJSOGHHM-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 2-amino-3-(4-chloro-3-hydroxyphenyl)propanoic acid;hydrochloride |
| InChIKey | JLLKYXUJSOGHHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)O)Cl.Cl |
Computed by PubChem (NCBI)