Products 3026691-18-6
CAS 3026691-18-6 is the registry number for Methyl 2-((2-bromo-6-nitrobenzyl)oxy)acetate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Methyl 2-[(2-bromo-6-nitrophenyl)methoxy]acetate (CAS 3026691-18-6) is a chemical compound with the molecular formula C10H10BrNO5 and a molecular weight of 304.09 g/mol. IUPAC name: methyl 2-[(2-bromo-6-nitrophenyl)methoxy]acetate. InChIKey: GGCMERMZEQBADA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO5 |
|---|---|
| Molecular weight | 304.09 g/mol |
| IUPAC name | methyl 2-[(2-bromo-6-nitrophenyl)methoxy]acetate |
| InChIKey | GGCMERMZEQBADA-UHFFFAOYSA-N |
| SMILES | COC(=O)COCC1=C(C=CC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)