Products 3026713-57-2
CAS 3026713-57-2 is the registry number for 2-chloro-8-methyl-5-(trifluoromethyl)quinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
2-chloro-8-methyl-5-(trifluoromethyl)quinoline (CAS 3026713-57-2) is a chemical compound with the molecular formula C11H7ClF3N and a molecular weight of 245.63 g/mol. IUPAC name: 2-chloro-8-methyl-5-(trifluoromethyl)quinoline. InChIKey: DXOGFUJTKNRMJU-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N |
|---|---|
| Molecular weight | 245.63 g/mol |
| IUPAC name | 2-chloro-8-methyl-5-(trifluoromethyl)quinoline |
| InChIKey | DXOGFUJTKNRMJU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C(F)(F)F)C=CC(=N2)Cl |
Computed by PubChem (NCBI)