Products 3029431-90-8
CAS 3029431-90-8 is the registry number for CLK1/4-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(5-chloro-2-methoxybenzoyl)-5-methoxy-1-benzothiophene-2-carboxamide (CAS 3029431-90-8) is a chemical compound with the molecular formula C18H14ClNO4S and a molecular weight of 375.8 g/mol. IUPAC name: N-(5-chloro-2-methoxybenzoyl)-5-methoxy-1-benzothiophene-2-carboxamide. InChIKey: YQLKBWUOUBOKRE-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO4S |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | N-(5-chloro-2-methoxybenzoyl)-5-methoxy-1-benzothiophene-2-carboxamide |
| InChIKey | YQLKBWUOUBOKRE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=C2)C(=O)NC(=O)C3=C(C=CC(=C3)Cl)OC |
Computed by PubChem (NCBI)