CAS 3030200-40-6 is the registry number for Tetrakis(7-bromo-9,9-dimethyl-9H-fluoren-2-yl)silane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tetrakis(7-bromo-9,9-dimethylfluoren-2-yl)silane (CAS 3030200-40-6) is a chemical compound with the molecular formula C60H48Br4Si and a molecular weight of 1116.7 g/mol. IUPAC name: tetrakis(7-bromo-9,9-dimethylfluoren-2-yl)silane. InChIKey: PLDKXYVLJIBNKS-UHFFFAOYSA-N.
| Molecular formula | C60H48Br4Si |
|---|---|
| Molecular weight | 1116.7 g/mol |
| IUPAC name | tetrakis(7-bromo-9,9-dimethylfluoren-2-yl)silane |
| InChIKey | PLDKXYVLJIBNKS-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)[Si](C3=CC4=C(C=C3)C5=C(C4(C)C)C=C(C=C5)Br)(C6=CC7=C(C=C6)C8=C(C7(C)C)C=C(C=C8)Br)C9=CC2=C(C=C9)C3=C(C2(C)C)C=C(C=C3)Br)C2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)