CAS 3031792-00-1 appears in our catalog under these names: 1-(Trifluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine hydrochloride, 95%, 1-(Trifluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
1-(trifluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride (CAS 3031792-00-1) is a chemical compound with the molecular formula C8H13ClF3NO and a molecular weight of 231.64 g/mol. IUPAC name: 1-(trifluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride. InChIKey: IZQSPFFAJCUNPN-UHFFFAOYSA-N.
| Molecular formula | C8H13ClF3NO |
|---|---|
| Molecular weight | 231.64 g/mol |
| IUPAC name | 1-(trifluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride |
| InChIKey | IZQSPFFAJCUNPN-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CO2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)