CAS 3032265-06-5 appears in our catalog under these names: DEG–77, DEG-77, 99.03%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 100 mg, 50 mg, 10 mg, 5 mg, 25 mg, 10mM/1mL.
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-8-methoxy-2H-chromene-3-carboxamide (CAS 3032265-06-5) is a chemical compound with the molecular formula C24H21N3O6 and a molecular weight of 447.4 g/mol. IUPAC name: N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-8-methoxy-2H-chromene-3-carboxamide. InChIKey: ZFAKJMUJUNDGEI-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O6 |
|---|---|
| Molecular weight | 447.4 g/mol |
| IUPAC name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-8-methoxy-2H-chromene-3-carboxamide |
| InChIKey | ZFAKJMUJUNDGEI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1OCC(=C2)C(=O)NC3=CC4=C(C=C3)C(=O)N(C4)C5CCC(=O)NC5=O |
Computed by PubChem (NCBI)