Products 3032387-88-2
CAS 3032387-88-2 is the registry number for FASN-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[[4-bromo-3-(trifluoromethyl)anilino]methyl]-3-(3-fluorophenyl)pyrazol-1-yl]benzoic acid (CAS 3032387-88-2) is a chemical compound with the molecular formula C24H16BrF4N3O2 and a molecular weight of 534.3 g/mol. IUPAC name: 4-[4-[[4-bromo-3-(trifluoromethyl)anilino]methyl]-3-(3-fluorophenyl)pyrazol-1-yl]benzoic acid. InChIKey: BBCNDXNURGQGSQ-UHFFFAOYSA-N.
| Molecular formula | C24H16BrF4N3O2 |
|---|---|
| Molecular weight | 534.3 g/mol |
| IUPAC name | 4-[4-[[4-bromo-3-(trifluoromethyl)anilino]methyl]-3-(3-fluorophenyl)pyrazol-1-yl]benzoic acid |
| InChIKey | BBCNDXNURGQGSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN(C=C2CNC3=CC(=C(C=C3)Br)C(F)(F)F)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)