Products 3032440-80-2
CAS 3032440-80-2 is the registry number for MPI60, 98.35%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 10 mg, 5 mg.
Benzyl 3-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamoyl]-2-azaspiro[4.4]nonane-2-carboxylate (CAS 3032440-80-2) is a chemical compound with the molecular formula C24H31N3O5 and a molecular weight of 441.5 g/mol. IUPAC name: benzyl 3-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamoyl]-2-azaspiro[4.4]nonane-2-carboxylate. InChIKey: OYFTZDRWXGWCFB-NFBCFJMWSA-N.
| Molecular formula | C24H31N3O5 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | benzyl 3-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]carbamoyl]-2-azaspiro[4.4]nonane-2-carboxylate |
| InChIKey | OYFTZDRWXGWCFB-NFBCFJMWSA-N |
| SMILES | C1CCC2(C1)CC(N(C2)C(=O)OCC3=CC=CC=C3)C(=O)N[C@@H](C[C@@H]4CCNC4=O)C=O |
Computed by PubChem (NCBI)