Products 3032921-67-5
CAS 3032921-67-5 is the registry number for (1-Boc-3,3-difluoropyrrolidin-2-yl)methanol, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (CAS 3032921-67-5) is a chemical compound with the molecular formula C11H16F3NO4 and a molecular weight of 283.24 g/mol. IUPAC name: (3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid. InChIKey: GNGVCLGQCJEPOE-JTQLQIEISA-N.
| Molecular formula | C11H16F3NO4 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | (3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GNGVCLGQCJEPOE-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)