CAS 3046190-03-5 is the registry number for 4-(3-(TRIFLUOROMETHYL)PHENYL)-7H-PYRROLO[2,3-D]PYRIMIDINE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine (CAS 3046190-03-5) is a chemical compound with the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: DOPQWAWKRNORCH-UHFFFAOYSA-N.
| Molecular formula | C13H8F3N3 |
|---|---|
| Molecular weight | 263.22 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | DOPQWAWKRNORCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=C3C=CNC3=NC=N2 |
Computed by PubChem (NCBI)