CAS 3052121-57-7 is the registry number for tert-butyl ((1R,5S,6s)-3-(piperidin-4-ylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[(1R,5S)-3-(piperidin-4-ylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (CAS 3052121-57-7) is a chemical compound with the molecular formula C16H29N3O2 and a molecular weight of 295.42 g/mol. IUPAC name: tert-butyl N-[(1R,5S)-3-(piperidin-4-ylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate. InChIKey: NPJJIQRRQMMSAS-PBWFPOADSA-N.
| Molecular formula | C16H29N3O2 |
|---|---|
| Molecular weight | 295.42 g/mol |
| IUPAC name | tert-butyl N-[(1R,5S)-3-(piperidin-4-ylmethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| InChIKey | NPJJIQRRQMMSAS-PBWFPOADSA-N |
| SMILES | CC(C)(C)OC(=O)NC1[C@H]2[C@@H]1CN(C2)CC3CCNCC3 |
Computed by PubChem (NCBI)