CAS 3055557-53-1 is the registry number for ((1aR,6aR,6bS)-5-Methylenehexahydrocyclopropa[a]pyrrolizin-6a(4H)-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(1R,2S,4R)-8-methylidene-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol (CAS 3055557-53-1) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: [(1R,2S,4R)-8-methylidene-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol. InChIKey: KFFSIPSOOXTHHI-GUBZILKMSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | [(1R,2S,4R)-8-methylidene-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol |
| InChIKey | KFFSIPSOOXTHHI-GUBZILKMSA-N |
| SMILES | C=C1C[C@@]2([C@H]3C[C@H]3CN2C1)CO |
Computed by PubChem (NCBI)