Products 3056394-59-0
CAS 3056394-59-0 is the registry number for KVS0001, 99.14%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 25 mg, 10mM/1mL, 50 mg, 5 mg.
1-[4-[4-[2-(4-chloro-3-piperazin-1-ylsulfonylanilino)pyrimidin-4-yl]-2-pyridinyl]phenyl]-3-methylurea (CAS 3056394-59-0) is a chemical compound with the molecular formula C27H27ClN8O3S and a molecular weight of 579.1 g/mol. IUPAC name: 1-[4-[4-[2-(4-chloro-3-piperazin-1-ylsulfonylanilino)pyrimidin-4-yl]-2-pyridinyl]phenyl]-3-methylurea. InChIKey: ZEGVOEXOEQDDKK-UHFFFAOYSA-N.
| Molecular formula | C27H27ClN8O3S |
|---|---|
| Molecular weight | 579.1 g/mol |
| IUPAC name | 1-[4-[4-[2-(4-chloro-3-piperazin-1-ylsulfonylanilino)pyrimidin-4-yl]-2-pyridinyl]phenyl]-3-methylurea |
| InChIKey | ZEGVOEXOEQDDKK-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1=CC=C(C=C1)C2=NC=CC(=C2)C3=NC(=NC=C3)NC4=CC(=C(C=C4)Cl)S(=O)(=O)N5CCNCC5 |
Computed by PubChem (NCBI)