Products 3056570-19-2
CAS 3056570-19-2 is the registry number for AZ'9567, 99.21%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 25 mg, 1 mg, 10 mg, 5 mg, 10mM/1mL.
3-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-6-(2-methylindazol-5-yl)-2H-pyrazolo[4,3-b]pyridin-5-one (CAS 3056570-19-2) is a chemical compound with the molecular formula C24H19F2N5O2 and a molecular weight of 447.4 g/mol. IUPAC name: 3-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-6-(2-methylindazol-5-yl)-2H-pyrazolo[4,3-b]pyridin-5-one. InChIKey: QEASMQZYZCGOSA-UHFFFAOYSA-N.
| Molecular formula | C24H19F2N5O2 |
|---|---|
| Molecular weight | 447.4 g/mol |
| IUPAC name | 3-cyclopropyl-4-[4-(difluoromethoxy)phenyl]-6-(2-methylindazol-5-yl)-2H-pyrazolo[4,3-b]pyridin-5-one |
| InChIKey | QEASMQZYZCGOSA-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=C(C=CC2=N1)C3=CC4=NNC(=C4N(C3=O)C5=CC=C(C=C5)OC(F)F)C6CC6 |
Computed by PubChem (NCBI)