CAS 3056833-36-1 is the registry number for (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]methanol (CAS 3056833-36-1) is a chemical compound with the molecular formula C13H23BO3 and a molecular weight of 238.13 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]methanol. InChIKey: IRWUYUOGEIWDLQ-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]methanol |
| InChIKey | IRWUYUOGEIWDLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)CO |
Computed by PubChem (NCBI)