CAS 306288-04-0 appears in our catalog under these names: AVE 0991 sodium salt, AVE 0991 sodium salt, AVE 0991 Sodium, 98.75%, 98.75%, AVE 0991 (sodium salt), 99.47%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 100 mg, 50 mg.
Sodium ethylcarbamoyl-[3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylazanide (CAS 306288-04-0) is a chemical compound with the molecular formula C29H31N4NaO5S2 and a molecular weight of 602.7 g/mol. IUPAC name: sodium ethylcarbamoyl-[3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylazanide. InChIKey: GABSTAFOMFJFOI-UHFFFAOYSA-M.
| Molecular formula | C29H31N4NaO5S2 |
|---|---|
| Molecular weight | 602.7 g/mol |
| IUPAC name | sodium ethylcarbamoyl-[3-[4-[(5-formyl-4-methoxy-2-phenylimidazol-1-yl)methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylazanide |
| InChIKey | GABSTAFOMFJFOI-UHFFFAOYSA-M |
| SMILES | CCNC(=O)[N-]S(=O)(=O)C1=C(C=C(S1)CC(C)C)C2=CC=C(C=C2)CN3C(=C(N=C3C4=CC=CC=C4)OC)C=O.[Na+] |
Computed by PubChem (NCBI)