CAS 3074099-81-0 is the registry number for (3-cyclopropyl-4-fluorophenyl)hydrazine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-cyclopropyl-4-fluorophenyl)hydrazine;hydrochloride (CAS 3074099-81-0) is a chemical compound with the molecular formula C9H12ClFN2 and a molecular weight of 202.65 g/mol. IUPAC name: (3-cyclopropyl-4-fluorophenyl)hydrazine;hydrochloride. InChIKey: ODMZZUFQWYRSCU-UHFFFAOYSA-N.
| Molecular formula | C9H12ClFN2 |
|---|---|
| Molecular weight | 202.65 g/mol |
| IUPAC name | (3-cyclopropyl-4-fluorophenyl)hydrazine;hydrochloride |
| InChIKey | ODMZZUFQWYRSCU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC(=C2)NN)F.Cl |
Computed by PubChem (NCBI)