Products 3076176-48-9
CAS 3076176-48-9 is the registry number for Ethyl 1-(5-Bromo-2-pyrazinyl)cyclopropanecarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 1-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate (CAS 3076176-48-9) is a chemical compound with the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. IUPAC name: ethyl 1-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate. InChIKey: GRSWNGGMMVWEMY-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O2 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | ethyl 1-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate |
| InChIKey | GRSWNGGMMVWEMY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)C2=CN=C(C=N2)Br |
Computed by PubChem (NCBI)