Products 3076954-42-9
CAS 3076954-42-9 is the registry number for THX6, 99.97%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 50 mg, 10 mg, 25 mg.
3-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]benzonitrile (CAS 3076954-42-9) is a chemical compound with the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.3 g/mol. IUPAC name: 3-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]benzonitrile. InChIKey: DQSWREBDNVEGNC-UHFFFAOYSA-N.
| Molecular formula | C22H18Cl2N4O2 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | 3-[[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]benzonitrile |
| InChIKey | DQSWREBDNVEGNC-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1NC(=O)N(C2=O)CC3=CC(=C(C=C3)Cl)Cl)CC4=CC(=CC=C4)C#N |
Computed by PubChem (NCBI)