Products 3092078-38-8
CAS 3092078-38-8 is the registry number for 5-(5-(Dimethylcarbamoyl)pyridin-2-yl)-1-methyl-1H-indazole-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
5-[5-(dimethylcarbamoyl)-2-pyridinyl]-1-methylindazole-3-carboxylic acid (CAS 3092078-38-8) is a chemical compound with the molecular formula C17H16N4O3 and a molecular weight of 324.33 g/mol. IUPAC name: 5-[5-(dimethylcarbamoyl)-2-pyridinyl]-1-methylindazole-3-carboxylic acid. InChIKey: QNDDIGCWCJXRIU-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O3 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | 5-[5-(dimethylcarbamoyl)-2-pyridinyl]-1-methylindazole-3-carboxylic acid |
| InChIKey | QNDDIGCWCJXRIU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C3=NC=C(C=C3)C(=O)N(C)C)C(=N1)C(=O)O |
Computed by PubChem (NCBI)