Products 3099010-20-2
CAS 3099010-20-2 is the registry number for PI4Kβ/PKG-IN-2, 99.34%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 100 mg, 50 mg.
5-[4-amino-1-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-1,3-benzoxazol-2-amine (CAS 3099010-20-2) is a chemical compound with the molecular formula C19H13Cl2N7O and a molecular weight of 426.3 g/mol. IUPAC name: 5-[4-amino-1-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-1,3-benzoxazol-2-amine. InChIKey: RPSPDODKZZQNMS-UHFFFAOYSA-N.
| Molecular formula | C19H13Cl2N7O |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | 5-[4-amino-1-[(3,4-dichlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-3-yl]-1,3-benzoxazol-2-amine |
| InChIKey | RPSPDODKZZQNMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN2C3=NC=NC(=C3C(=N2)C4=CC5=C(C=C4)OC(=N5)N)N)Cl)Cl |
Computed by PubChem (NCBI)