CAS 31411-71-9 is the registry number for 2,3-bis(Trimethylsilyloxy)-1,3-butadiene, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Trimethyl(3-trimethylsilyloxybuta-1,3-dien-2-yloxy)silane (CAS 31411-71-9) is a chemical compound with the molecular formula C10H22O2Si2 and a molecular weight of 230.45 g/mol. IUPAC name: trimethyl(3-trimethylsilyloxybuta-1,3-dien-2-yloxy)silane. InChIKey: BEIXTGGJVNHLEO-UHFFFAOYSA-N.
| Molecular formula | C10H22O2Si2 |
|---|---|
| Molecular weight | 230.45 g/mol |
| IUPAC name | trimethyl(3-trimethylsilyloxybuta-1,3-dien-2-yloxy)silane |
| InChIKey | BEIXTGGJVNHLEO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=C)C(=C)O[Si](C)(C)C |
Computed by PubChem (NCBI)