CAS 31599-94-7 is the registry number for 3-(Methyl-d3)butan-2-one-4,4,4-d3. Offered by: TRC. Available pack sizes: 250mg.
1,1,1,3-tetradeuterio-3-methylbutan-2-one (CAS 31599-94-7) is a chemical compound with the molecular formula C5H10O and a molecular weight of 90.16 g/mol. IUPAC name: 1,1,1,3-tetradeuterio-3-methylbutan-2-one. InChIKey: SYBYTAAJFKOIEJ-LNVGMWHISA-N.
| Molecular formula | C5H10O |
|---|---|
| Molecular weight | 90.16 g/mol |
| IUPAC name | 1,1,1,3-tetradeuterio-3-methylbutan-2-one |
| InChIKey | SYBYTAAJFKOIEJ-LNVGMWHISA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])(C)C |
Computed by PubChem (NCBI)