Products 327070-23-5
CAS 327070-23-5 is the registry number for 4-(2-(4-((3-Chloro-2-methylphenyl)amino)-4-oxobutanoyl)hydrazinyl)-4-oxobut-2-enoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-[2-[4-(3-chloro-2-methylanilino)-4-oxobutanoyl]hydrazinyl]-4-oxobut-2-enoic acid (CAS 327070-23-5) is a chemical compound with the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. IUPAC name: (E)-4-[2-[4-(3-chloro-2-methylanilino)-4-oxobutanoyl]hydrazinyl]-4-oxobut-2-enoic acid. InChIKey: RQMCEKYUSWHLSD-BQYQJAHWSA-N.
| Molecular formula | C15H16ClN3O5 |
|---|---|
| Molecular weight | 353.76 g/mol |
| IUPAC name | (E)-4-[2-[4-(3-chloro-2-methylanilino)-4-oxobutanoyl]hydrazinyl]-4-oxobut-2-enoic acid |
| InChIKey | RQMCEKYUSWHLSD-BQYQJAHWSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)CCC(=O)NNC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)