CAS 331258-31-2 appears in our catalog under these names: Diethyl 2,6-bis((2-aminoethoxy)methyl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, 95%, Amlodipine Impurity 21, Amlodipine Impurity 63, Amlodipine Impurity 23. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Diethyl 2,6-bis(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 331258-31-2) is a chemical compound with the molecular formula C23H32ClN3O6 and a molecular weight of 482.0 g/mol. IUPAC name: diethyl 2,6-bis(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: CMJMFGWMGFKEFU-UHFFFAOYSA-N.
| Molecular formula | C23H32ClN3O6 |
|---|---|
| Molecular weight | 482.0 g/mol |
| IUPAC name | diethyl 2,6-bis(2-aminoethoxymethyl)-4-(2-chlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | CMJMFGWMGFKEFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OCC)COCCN)COCCN |
Computed by PubChem (NCBI)