Products 334981-31-6
CAS 334981-31-6 appears in our catalog under these names: Almotriptan Impurity 4, Almotriptan Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-6-(pyrrolidin-1-ylsulfonylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (CAS 334981-31-6) is a chemical compound with the molecular formula C17H23N3O2S and a molecular weight of 333.5 g/mol. IUPAC name: 2-methyl-6-(pyrrolidin-1-ylsulfonylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole. InChIKey: JTRWBUALGSUDBJ-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O2S |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | 2-methyl-6-(pyrrolidin-1-ylsulfonylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| InChIKey | JTRWBUALGSUDBJ-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)NC3=C2C=C(C=C3)CS(=O)(=O)N4CCCC4 |
Computed by PubChem (NCBI)