CAS 343868-74-6 appears in our catalog under these names: 8-Chloroquinolin-2-amine, 95%, 8-Chloroquinolin-2-amine, 95+%, 8-Chloroquinolin-2-amine, 8-Chloroquinolin-2-amine, 98%, 98%, 8-CHLOROQUINOLIN-2-AMINE, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 50mg, 0,5g, 100mg.
8-chloroquinolin-2-amine (CAS 343868-74-6) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 8-chloroquinolin-2-amine. InChIKey: CKYLCXRCRTXTJH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 8-chloroquinolin-2-amine |
| InChIKey | CKYLCXRCRTXTJH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(C=C2)N |
Computed by PubChem (NCBI)