CAS 34393-18-5 appears in our catalog under these names: Fructose-leucine (mixture of diastereomers), >95% (HPLC), Fructose-leucine, 99.89%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg.
(2R)-4-methyl-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid (CAS 34393-18-5) is a chemical compound with the molecular formula C12H23NO7 and a molecular weight of 293.31 g/mol. IUPAC name: (2R)-4-methyl-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid. InChIKey: ZVFBUGZJZNDPOS-OQQZPARHSA-N.
| Molecular formula | C12H23NO7 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | (2R)-4-methyl-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid |
| InChIKey | ZVFBUGZJZNDPOS-OQQZPARHSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NCC1([C@H]([C@@H]([C@@H](CO1)O)O)O)O |
Computed by PubChem (NCBI)