CAS 345650-25-1 is the registry number for 3,3',3''-(Thioxo-l5-phosphanetriyl)tribenzenesulfonic acid, sodium salt, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
CAS 345650-25-1 identifies a chemical compound with the molecular formula C18H15NaO9PS4 and a molecular weight of 557.5 g/mol. InChIKey: LNWQITXJYZKJBO-UHFFFAOYSA-N.
| Molecular formula | C18H15NaO9PS4 |
|---|---|
| Molecular weight | 557.5 g/mol |
| InChIKey | LNWQITXJYZKJBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)O)P(=S)(C2=CC(=CC=C2)S(=O)(=O)O)C3=CC(=CC=C3)S(=O)(=O)O.[Na] |
Computed by PubChem (NCBI)