Products 350818-58-5
CAS 350818-58-5 is the registry number for 2-Methyl-1-phenylpropane-d14, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g, 1g.
1,2,3,4,5-pentadeuterio-6-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]benzene (CAS 350818-58-5) is a chemical compound with the molecular formula C10H14 and a molecular weight of 148.30 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]benzene. InChIKey: KXUHSQYYJYAXGZ-QUMROUDOSA-N.
| Molecular formula | C10H14 |
|---|---|
| Molecular weight | 148.30 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl]benzene |
| InChIKey | KXUHSQYYJYAXGZ-QUMROUDOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)