Products 3608-49-9

CAS 3608-49-9 is the registry number for 2-(4-Chlorophenyl)naphth[2,1-d]oxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-(4-chlorophenyl)benzo[g][1,3]benzoxazole (CAS 3608-49-9) is a chemical compound with the molecular formula C17H10ClNO and a molecular weight of 279.7 g/mol. IUPAC name: 2-(4-chlorophenyl)benzo[g][1,3]benzoxazole. InChIKey: DDFDMNGXKCMWGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H10ClNO
Molecular weight279.7 g/mol
IUPAC name2-(4-chlorophenyl)benzo[g][1,3]benzoxazole
InChIKeyDDFDMNGXKCMWGQ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC3=C2OC(=N3)C4=CC=C(C=C4)Cl

Computed by PubChem (NCBI)