Products 365542-82-1
CAS 365542-82-1 is the registry number for Methyl (E)-2-(2-(3-(diethylamino)-1-oxo-1H-benzo[f]chromen-2-yl)vinyl)-6-methoxybenzoate, mix TBC as stabilizer. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(E)-2-[3-(diethylamino)-1-oxobenzo[f]chromen-2-yl]ethenyl]-6-methoxybenzoate (CAS 365542-82-1) is a chemical compound with the molecular formula C28H27NO5 and a molecular weight of 457.5 g/mol. IUPAC name: methyl 2-[(E)-2-[3-(diethylamino)-1-oxobenzo[f]chromen-2-yl]ethenyl]-6-methoxybenzoate. InChIKey: VVTUPLMRUAQYCL-JQIJEIRASA-N.
| Molecular formula | C28H27NO5 |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | methyl 2-[(E)-2-[3-(diethylamino)-1-oxobenzo[f]chromen-2-yl]ethenyl]-6-methoxybenzoate |
| InChIKey | VVTUPLMRUAQYCL-JQIJEIRASA-N |
| SMILES | CCN(CC)C1=C(C(=O)C2=C(O1)C=CC3=CC=CC=C32)/C=C/C4=C(C(=CC=C4)OC)C(=O)OC |
Computed by PubChem (NCBI)