CAS 36739-99-8 is the registry number for 3-Bromo-5-chlorobenzofuran, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-5-chloro-1-benzofuran (CAS 36739-99-8) is a chemical compound with the molecular formula C8H4BrClO and a molecular weight of 231.47 g/mol. IUPAC name: 3-bromo-5-chloro-1-benzofuran. InChIKey: COGXMMSJMPDDBM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClO |
|---|---|
| Molecular weight | 231.47 g/mol |
| IUPAC name | 3-bromo-5-chloro-1-benzofuran |
| InChIKey | COGXMMSJMPDDBM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CO2)Br |
Computed by PubChem (NCBI)