Products 372491-73-1
CAS 372491-73-1 is the registry number for DTS-201 (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
CAS 372491-73-1 identifies a chemical compound with the molecular formula C49H65N5NaO18 and a molecular weight of 1035.1 g/mol. InChIKey: ROSZGOSTNUTAPV-VAWHKMFHSA-N.
| Molecular formula | C49H65N5NaO18 |
|---|---|
| Molecular weight | 1035.1 g/mol |
| InChIKey | ROSZGOSTNUTAPV-VAWHKMFHSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)CCNC(=O)CCC(=O)O)O.[Na] |
Computed by PubChem (NCBI)