CAS 3757-06-0 is the registry number for 2-Oxo-2H-1-benzopyran-3-carbonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-oxochromene-3-carbonyl chloride (CAS 3757-06-0) is a chemical compound with the molecular formula C10H5ClO3 and a molecular weight of 208.60 g/mol. IUPAC name: 2-oxochromene-3-carbonyl chloride. InChIKey: IVEOLEMGKYWBTC-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO3 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 2-oxochromene-3-carbonyl chloride |
| InChIKey | IVEOLEMGKYWBTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)Cl |
Computed by PubChem (NCBI)