CAS 37832-25-0 is the registry number for 10-Phenyl-10H-phenoxazine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
10-phenylphenoxazine (CAS 37832-25-0) is a chemical compound with the molecular formula C18H13NO and a molecular weight of 259.3 g/mol. IUPAC name: 10-phenylphenoxazine. InChIKey: LAVLDGSVWFEKJG-UHFFFAOYSA-N.
| Molecular formula | C18H13NO |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 10-phenylphenoxazine |
| InChIKey | LAVLDGSVWFEKJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3OC4=CC=CC=C42 |
Computed by PubChem (NCBI)