CAS 3787-09-5 is the registry number for 1,4-Dihydro-1,2,4,5-tetrazine-3,6-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylic acid (CAS 3787-09-5) is a chemical compound with the molecular formula C4H4N4O4 and a molecular weight of 172.10 g/mol. IUPAC name: 1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylic acid. InChIKey: BJEZXJBWVBDMLN-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O4 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | 1,4-dihydro-1,2,4,5-tetrazine-3,6-dicarboxylic acid |
| InChIKey | BJEZXJBWVBDMLN-UHFFFAOYSA-N |
| SMILES | C1(=NNC(=NN1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)