Products 381664-92-2

CAS 381664-92-2 is the registry number for 1-ETHYLCYCLOPENTYL 2-CHLOROACETATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(1-ethylcyclopentyl) 2-chloroacetate (CAS 381664-92-2) is a chemical compound with the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. IUPAC name: (1-ethylcyclopentyl) 2-chloroacetate. InChIKey: OZNXJXNWTDEPNB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15ClO2
Molecular weight190.67 g/mol
IUPAC name(1-ethylcyclopentyl) 2-chloroacetate
InChIKeyOZNXJXNWTDEPNB-UHFFFAOYSA-N
SMILESCCC1(CCCC1)OC(=O)CCl

Computed by PubChem (NCBI)