Products 38575-74-5
CAS 38575-74-5 appears in our catalog under these names: VIS-638 Pentamethine-, Cyanine BF4-, 1 g, glass, VIS-638 Pentamethine-, Cyanine BF4-, 5 g, plastic, VIS-638 Pentamethine-, Cyanine BF4-, 10 g, plastic. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
(2Z)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole tetrafluoroborate (CAS 38575-74-5) is a chemical compound with the molecular formula C27H31BF4N2 and a molecular weight of 470.4 g/mol. IUPAC name: (2Z)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole tetrafluoroborate. InChIKey: USJIDBJWISIARO-UHFFFAOYSA-N.
| Molecular formula | C27H31BF4N2 |
|---|---|
| Molecular weight | 470.4 g/mol |
| IUPAC name | (2Z)-1,3,3-trimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole tetrafluoroborate |
| InChIKey | USJIDBJWISIARO-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/C=C\3/C(C4=CC=CC=C4N3C)(C)C)C)C |
Computed by PubChem (NCBI)