CAS 392703-95-6 appears in our catalog under these names: 2-(N-(2,4-Difluorophenyl)carbamoyl)cyclohexanecarboxylic acid, 95%, 2-((2,4-Difluorophenyl)carbamoyl)cyclohexane-1-carboxylic acid, 97%, 2-(N-(2,4-Difluorophenyl)carbamoyl)cyclohexanecarboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
2-[(2,4-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 392703-95-6) is a chemical compound with the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. IUPAC name: 2-[(2,4-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: RVYFZANWXUMSSV-UHFFFAOYSA-N.
| Molecular formula | C14H15F2NO3 |
|---|---|
| Molecular weight | 283.27 g/mol |
| IUPAC name | 2-[(2,4-difluorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| InChIKey | RVYFZANWXUMSSV-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(=O)NC2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)