Products 40818-86-8
CAS 40818-86-8 appears in our catalog under these names: Cefathiamidine Impurity 5, Cefathiamidine Impurity 1, Cefradine Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-7-[(2-chloroacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 40818-86-8) is a chemical compound with the molecular formula C10H11ClN2O4S and a molecular weight of 290.72 g/mol. IUPAC name: (6R,7R)-7-[(2-chloroacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: MFZJRMPXTUBQDD-HZGVNTEJSA-N.
| Molecular formula | C10H11ClN2O4S |
|---|---|
| Molecular weight | 290.72 g/mol |
| IUPAC name | (6R,7R)-7-[(2-chloroacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | MFZJRMPXTUBQDD-HZGVNTEJSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCl)SC1)C(=O)O |
Computed by PubChem (NCBI)