CAS 410077-21-3 is the registry number for Camostat HCl. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)benzoate;hydrochloride (CAS 410077-21-3) is a chemical compound with the molecular formula C20H23ClN4O5 and a molecular weight of 434.9 g/mol. IUPAC name: [4-[2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)benzoate;hydrochloride. InChIKey: LJMUBVFXGFAKKZ-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN4O5 |
|---|---|
| Molecular weight | 434.9 g/mol |
| IUPAC name | [4-[2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl]phenyl] 4-(diaminomethylideneamino)benzoate;hydrochloride |
| InChIKey | LJMUBVFXGFAKKZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC(=O)CC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)N=C(N)N.Cl |
Computed by PubChem (NCBI)